C13H20N2O4 — CID 171869443
3-[4-(diethylamino)-2-hydroxyphenyl]-2,3-dihydroxypropanamide (PubChem CID 171869443) has the molecular formula C13H20N2O4 and a molecular weight of 268.31 g/mol. Its IUPAC name is 3-[4-(diethylamino)-2-hydroxyphenyl]-2,3-dihydroxypropanamide.
| Compound Name | 3-[4-(diethylamino)-2-hydroxyphenyl]-2,3-dihydroxypropanamide |
|---|---|
| PubChem CID | 171869443 |
| Molecular Formula | C13H20N2O4 |
| Molecular Weight | 268.31 g/mol |
| Exact Mass | 268.14 |
| IUPAC Name | 3-[4-(diethylamino)-2-hydroxyphenyl]-2,3-dihydroxypropanamide |
| SMILES | CCN(CC)c1ccc(C(O)C(O)C(N)=O)c(O)c1 |
| InChI | InChI=1S/C13H20N2O4/c1-3-15(4-2)8-5-6-9(10(16)7-8)11(17)12(18)13(14)19/h5-7,11-12,16-18H,3-4H2,1-2H3,(H2,14,19) |
| InChIKey | QKZQXEVCOFEAJC-UHFFFAOYSA-N |
| XLogP | 0.12 |
| TPSA | 107.02 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.31 |
| LogP ≤ 5 | 0.12 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'} |
|---|