C14H24N2O3 — CID 171859206
1-[4-(diethylamino)-2-hydroxyphenyl]-3-(methylamino)propane-1,2-diol (PubChem CID 171859206) has the molecular formula C14H24N2O3 and a molecular weight of 268.36 g/mol. Its IUPAC name is 1-[4-(diethylamino)-2-hydroxyphenyl]-3-(methylamino)propane-1,2-diol.
| Compound Name | 1-[4-(diethylamino)-2-hydroxyphenyl]-3-(methylamino)propane-1,2-diol |
|---|---|
| PubChem CID | 171859206 |
| Molecular Formula | C14H24N2O3 |
| Molecular Weight | 268.36 g/mol |
| Exact Mass | 268.18 |
| IUPAC Name | 1-[4-(diethylamino)-2-hydroxyphenyl]-3-(methylamino)propane-1,2-diol |
| SMILES | CCN(CC)c1ccc(C(O)C(O)CNC)c(O)c1 |
| InChI | InChI=1S/C14H24N2O3/c1-4-16(5-2)10-6-7-11(12(17)8-10)14(19)13(18)9-15-3/h6-8,13-15,17-19H,4-5,9H2,1-3H3 |
| InChIKey | BNFXVFFZWIWZFY-UHFFFAOYSA-N |
| XLogP | 0.85 |
| TPSA | 75.96 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.36 |
| LogP ≤ 5 | 0.85 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'} |
|---|