C17H31N3O — CID 102994161
2-(1-aminoethyl)-5-[3-(diethylamino)propyl-ethylamino]phenol (PubChem CID 102994161) has the molecular formula C17H31N3O and a molecular weight of 293.46 g/mol. Its IUPAC name is 2-(1-aminoethyl)-5-[3-(diethylamino)propyl-ethylamino]phenol.
| Compound Name | 2-(1-aminoethyl)-5-[3-(diethylamino)propyl-ethylamino]phenol |
|---|---|
| PubChem CID | 102994161 |
| Molecular Formula | C17H31N3O |
| Molecular Weight | 293.46 g/mol |
| Exact Mass | 293.25 |
| IUPAC Name | 2-(1-aminoethyl)-5-[3-(diethylamino)propyl-ethylamino]phenol |
| SMILES | CCN(CC)CCCN(CC)c1ccc(C(C)N)c(O)c1 |
| InChI | InChI=1S/C17H31N3O/c1-5-19(6-2)11-8-12-20(7-3)15-9-10-16(14(4)18)17(21)13-15/h9-10,13-14,21H,5-8,11-12,18H2,1-4H3 |
| InChIKey | SRKLPRHXAVWDHV-UHFFFAOYSA-N |
| XLogP | 2.97 |
| TPSA | 52.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.46 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|