C11H18ClNO2 — CID 171246640
2-[(1R)-1-amino-3-hydroxy-2,2-dimethylpropyl]phenol;hydrochloride (PubChem CID 171246640) has the molecular formula C11H18ClNO2 and a molecular weight of 231.72 g/mol. Its IUPAC name is 2-[(1R)-1-amino-3-hydroxy-2,2-dimethylpropyl]phenol;hydrochloride.
| Compound Name | 2-[(1R)-1-amino-3-hydroxy-2,2-dimethylpropyl]phenol;hydrochloride |
|---|---|
| PubChem CID | 171246640 |
| Molecular Formula | C11H18ClNO2 |
| Molecular Weight | 231.72 g/mol |
| Exact Mass | 231.10 |
| IUPAC Name | 2-[(1R)-1-amino-3-hydroxy-2,2-dimethylpropyl]phenol;hydrochloride |
| SMILES | CC(C)(CO)[C@@H](N)c1ccccc1O.Cl |
| InChI | InChI=1S/C11H17NO2.ClH/c1-11(2,7-13)10(12)8-5-3-4-6-9(8)14;/h3-6,10,13-14H,7,12H2,1-2H3;1H/t10-;/m0./s1 |
| InChIKey | KWQBOYATGNLSHU-PPHPATTJSA-N |
| XLogP | 1.83 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 231.72 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|