C31H47NO5 — CID 139706230
N-[2-tert-butyl-5-(1-hydroxyethyl)phenyl]-3-[3-(2-methoxyethoxymethoxymethyl)phenyl]octanamide (PubChem CID 139706230) has the molecular formula C31H47NO5 and a molecular weight of 513.72 g/mol. Its IUPAC name is N-[2-tert-butyl-5-(1-hydroxyethyl)phenyl]-3-[3-(2-methoxyethoxymethoxymethyl)phenyl]octanamide.
| Compound Name | N-[2-tert-butyl-5-(1-hydroxyethyl)phenyl]-3-[3-(2-methoxyethoxymethoxymethyl)phenyl]octanamide |
|---|---|
| PubChem CID | 139706230 |
| Molecular Formula | C31H47NO5 |
| Molecular Weight | 513.72 g/mol |
| Exact Mass | 513.35 |
| IUPAC Name | N-[2-tert-butyl-5-(1-hydroxyethyl)phenyl]-3-[3-(2-methoxyethoxymethoxymethyl)phenyl]octanamide |
| SMILES | CCCCCC(CC(=O)Nc1cc(C(C)O)ccc1C(C)(C)C)c1cccc(COCOCCOC)c1 |
| InChI | InChI=1S/C31H47NO5/c1-7-8-9-12-27(26-13-10-11-24(18-26)21-37-22-36-17-16-35-6)20-30(34)32-29-19-25(23(2)33)14-15-28(29)31(3,4)5/h10-11,13-15,18-19,23,27,33H,7-9,12,16-17,20-22H2,1-6H3,(H,32,34) |
| InChIKey | UOPMWPAMDDMPSD-UHFFFAOYSA-N |
| XLogP | 6.87 |
| TPSA | 77.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 513.72 |
| LogP ≤ 5 | 6.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|