C20H23ClO5S — CID 23047891
2-(4-chlorophenyl)sulfonyl-7-(2-methoxyphenyl)heptanoic acid (PubChem CID 23047891) has the molecular formula C20H23ClO5S and a molecular weight of 410.92 g/mol. Its IUPAC name is 2-(4-chlorophenyl)sulfonyl-7-(2-methoxyphenyl)heptanoic acid.
| Compound Name | 2-(4-chlorophenyl)sulfonyl-7-(2-methoxyphenyl)heptanoic acid |
|---|---|
| PubChem CID | 23047891 |
| Molecular Formula | C20H23ClO5S |
| Molecular Weight | 410.92 g/mol |
| Exact Mass | 410.10 |
| IUPAC Name | 2-(4-chlorophenyl)sulfonyl-7-(2-methoxyphenyl)heptanoic acid |
| SMILES | COc1ccccc1CCCCCC(C(=O)O)S(=O)(=O)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C20H23ClO5S/c1-26-18-9-6-5-8-15(18)7-3-2-4-10-19(20(22)23)27(24,25)17-13-11-16(21)12-14-17/h5-6,8-9,11-14,19H,2-4,7,10H2,1H3,(H,22,23) |
| InChIKey | DRTGRHOTZDZJAY-UHFFFAOYSA-N |
| XLogP | 4.38 |
| TPSA | 80.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.92 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|