C11H17NO4S — CID 117037408
2-amino-1-(4-propan-2-yloxyphenyl)sulfonylethanol (PubChem CID 117037408) has the molecular formula C11H17NO4S and a molecular weight of 259.33 g/mol. Its IUPAC name is 2-amino-1-(4-propan-2-yloxyphenyl)sulfonylethanol.
| Compound Name | 2-amino-1-(4-propan-2-yloxyphenyl)sulfonylethanol |
|---|---|
| PubChem CID | 117037408 |
| Molecular Formula | C11H17NO4S |
| Molecular Weight | 259.33 g/mol |
| Exact Mass | 259.09 |
| IUPAC Name | 2-amino-1-(4-propan-2-yloxyphenyl)sulfonylethanol |
| SMILES | CC(C)Oc1ccc(S(=O)(=O)C(O)CN)cc1 |
| InChI | InChI=1S/C11H17NO4S/c1-8(2)16-9-3-5-10(6-4-9)17(14,15)11(13)7-12/h3-6,8,11,13H,7,12H2,1-2H3 |
| InChIKey | NKCXHLFNIBLYFW-UHFFFAOYSA-N |
| XLogP | 0.52 |
| TPSA | 89.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.33 |
| LogP ≤ 5 | 0.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |