C10H15NO3S — CID 115000801
(4-propan-2-yloxyphenyl)methanesulfonamide (PubChem CID 115000801) has the molecular formula C10H15NO3S and a molecular weight of 229.30 g/mol. Its IUPAC name is (4-propan-2-yloxyphenyl)methanesulfonamide.
| Compound Name | (4-propan-2-yloxyphenyl)methanesulfonamide |
|---|---|
| PubChem CID | 115000801 |
| Molecular Formula | C10H15NO3S |
| Molecular Weight | 229.30 g/mol |
| Exact Mass | 229.08 |
| IUPAC Name | (4-propan-2-yloxyphenyl)methanesulfonamide |
| SMILES | CC(C)Oc1ccc(CS(N)(=O)=O)cc1 |
| InChI | InChI=1S/C10H15NO3S/c1-8(2)14-10-5-3-9(4-6-10)7-15(11,12)13/h3-6,8H,7H2,1-2H3,(H2,11,12,13) |
| InChIKey | FGQCLLDQZPJFEN-UHFFFAOYSA-N |
| XLogP | 1.26 |
| TPSA | 69.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.30 |
| LogP ≤ 5 | 1.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |