C19H26N2O3S — CID 120664319
N-(3-aminopropyl)-N-benzyl-4-propan-2-yloxybenzenesulfonamide (PubChem CID 120664319) has the molecular formula C19H26N2O3S and a molecular weight of 362.50 g/mol. Its IUPAC name is N-(3-aminopropyl)-N-benzyl-4-propan-2-yloxybenzenesulfonamide.
| Compound Name | N-(3-aminopropyl)-N-benzyl-4-propan-2-yloxybenzenesulfonamide |
|---|---|
| PubChem CID | 120664319 |
| Molecular Formula | C19H26N2O3S |
| Molecular Weight | 362.50 g/mol |
| Exact Mass | 362.17 |
| IUPAC Name | N-(3-aminopropyl)-N-benzyl-4-propan-2-yloxybenzenesulfonamide |
| SMILES | CC(C)Oc1ccc(S(=O)(=O)N(CCCN)Cc2ccccc2)cc1 |
| InChI | InChI=1S/C19H26N2O3S/c1-16(2)24-18-9-11-19(12-10-18)25(22,23)21(14-6-13-20)15-17-7-4-3-5-8-17/h3-5,7-12,16H,6,13-15,20H2,1-2H3 |
| InChIKey | BPTGYHRGSNHNRC-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 72.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.50 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |