C12H17NO2S3 — CID 11141222
N-[bis(methylsulfanyl)methylidene]-2,4,6-trimethylbenzenesulfonamide (PubChem CID 11141222) has the molecular formula C12H17NO2S3 and a molecular weight of 303.47 g/mol. Its IUPAC name is N-[bis(methylsulfanyl)methylidene]-2,4,6-trimethylbenzenesulfonamide.
| Compound Name | N-[bis(methylsulfanyl)methylidene]-2,4,6-trimethylbenzenesulfonamide |
|---|---|
| PubChem CID | 11141222 |
| Molecular Formula | C12H17NO2S3 |
| Molecular Weight | 303.47 g/mol |
| Exact Mass | 303.04 |
| IUPAC Name | N-[bis(methylsulfanyl)methylidene]-2,4,6-trimethylbenzenesulfonamide |
| SMILES | CSC(=NS(=O)(=O)c1c(C)cc(C)cc1C)SC |
| InChI | InChI=1S/C12H17NO2S3/c1-8-6-9(2)11(10(3)7-8)18(14,15)13-12(16-4)17-5/h6-7H,1-5H3 |
| InChIKey | UEPOYEFGRCHXCC-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 46.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.47 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|