C12H18N2O2S — CID 165176417
N,N-dimethyl-N'-(2,4,6-trimethylphenyl)sulfonylmethanimidamide (PubChem CID 165176417) has the molecular formula C12H18N2O2S and a molecular weight of 254.35 g/mol. Its IUPAC name is N,N-dimethyl-N'-(2,4,6-trimethylphenyl)sulfonylmethanimidamide.
| Compound Name | N,N-dimethyl-N'-(2,4,6-trimethylphenyl)sulfonylmethanimidamide |
|---|---|
| PubChem CID | 165176417 |
| Molecular Formula | C12H18N2O2S |
| Molecular Weight | 254.35 g/mol |
| Exact Mass | 254.11 |
| IUPAC Name | N,N-dimethyl-N'-(2,4,6-trimethylphenyl)sulfonylmethanimidamide |
| SMILES | Cc1cc(C)c(S(=O)(=O)N=CN(C)C)c(C)c1 |
| InChI | InChI=1S/C12H18N2O2S/c1-9-6-10(2)12(11(3)7-9)17(15,16)13-8-14(4)5/h6-8H,1-5H3 |
| InChIKey | GMNPBQYCCFCMGC-UHFFFAOYSA-N |
| XLogP | 1.89 |
| TPSA | 49.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.35 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|