C7H9BrN2O2S2 — CID 15599372
N'-(5-bromothiophen-2-yl)sulfonyl-N,N-dimethylmethanimidamide (PubChem CID 15599372) has the molecular formula C7H9BrN2O2S2 and a molecular weight of 297.20 g/mol. Its IUPAC name is N'-(5-bromothiophen-2-yl)sulfonyl-N,N-dimethylmethanimidamide.
| Compound Name | N'-(5-bromothiophen-2-yl)sulfonyl-N,N-dimethylmethanimidamide |
|---|---|
| PubChem CID | 15599372 |
| Molecular Formula | C7H9BrN2O2S2 |
| Molecular Weight | 297.20 g/mol |
| Exact Mass | 295.93 |
| IUPAC Name | N'-(5-bromothiophen-2-yl)sulfonyl-N,N-dimethylmethanimidamide |
| SMILES | CN(C)/C=N/S(=O)(=O)c1ccc(Br)s1 |
| InChI | InChI=1S/C7H9BrN2O2S2/c1-10(2)5-9-14(11,12)7-4-3-6(8)13-7/h3-5H,1-2H3/b9-5+ |
| InChIKey | SQXPQOHYLPTCHJ-WEVVVXLNSA-N |
| XLogP | 1.79 |
| TPSA | 49.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.20 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|