C17H20N2O2S — CID 173274455
N,N-dimethyl-N'-[3-[(3-methylphenyl)methyl]phenyl]sulfonylmethanimidamide (PubChem CID 173274455) has the molecular formula C17H20N2O2S and a molecular weight of 316.43 g/mol. Its IUPAC name is N,N-dimethyl-N'-[3-[(3-methylphenyl)methyl]phenyl]sulfonylmethanimidamide.
| Compound Name | N,N-dimethyl-N'-[3-[(3-methylphenyl)methyl]phenyl]sulfonylmethanimidamide |
|---|---|
| PubChem CID | 173274455 |
| Molecular Formula | C17H20N2O2S |
| Molecular Weight | 316.43 g/mol |
| Exact Mass | 316.12 |
| IUPAC Name | N,N-dimethyl-N'-[3-[(3-methylphenyl)methyl]phenyl]sulfonylmethanimidamide |
| SMILES | Cc1cccc(Cc2cccc(S(=O)(=O)N=CN(C)C)c2)c1 |
| InChI | InChI=1S/C17H20N2O2S/c1-14-6-4-7-15(10-14)11-16-8-5-9-17(12-16)22(20,21)18-13-19(2)3/h4-10,12-13H,11H2,1-3H3 |
| InChIKey | XYRBKXFDEBGKTC-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 49.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.43 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|