C8H10O5S — CID 40592817
(S)-hydroxy-(2-hydroxy-5-methylphenyl)methanesulfonic acid (PubChem CID 40592817) has the molecular formula C8H10O5S and a molecular weight of 218.23 g/mol. Its IUPAC name is (S)-hydroxy-(2-hydroxy-5-methylphenyl)methanesulfonic acid.
| Compound Name | (S)-hydroxy-(2-hydroxy-5-methylphenyl)methanesulfonic acid |
|---|---|
| PubChem CID | 40592817 |
| Molecular Formula | C8H10O5S |
| Molecular Weight | 218.23 g/mol |
| Exact Mass | 218.02 |
| IUPAC Name | (S)-hydroxy-(2-hydroxy-5-methylphenyl)methanesulfonic acid |
| SMILES | Cc1ccc(O)c([C@@H](O)S(=O)(=O)O)c1 |
| InChI | InChI=1S/C8H10O5S/c1-5-2-3-7(9)6(4-5)8(10)14(11,12)13/h2-4,8-10H,1H3,(H,11,12,13)/t8-/m0/s1 |
| InChIKey | HJGIZCGVMWNGBT-QMMMGPOBSA-N |
| XLogP | 0.58 |
| TPSA | 94.83 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.23 |
| LogP ≤ 5 | 0.58 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|