C7H8O6S — CID 23516386
(3,4-dihydroxyphenyl)-hydroxymethanesulfonic acid (PubChem CID 23516386) has the molecular formula C7H8O6S and a molecular weight of 220.20 g/mol. Its IUPAC name is (3,4-dihydroxyphenyl)-hydroxymethanesulfonic acid.
| Compound Name | (3,4-dihydroxyphenyl)-hydroxymethanesulfonic acid |
|---|---|
| PubChem CID | 23516386 |
| Molecular Formula | C7H8O6S |
| Molecular Weight | 220.20 g/mol |
| Exact Mass | 220.00 |
| IUPAC Name | (3,4-dihydroxyphenyl)-hydroxymethanesulfonic acid |
| SMILES | O=S(=O)(O)C(O)c1ccc(O)c(O)c1 |
| InChI | InChI=1S/C7H8O6S/c8-5-2-1-4(3-6(5)9)7(10)14(11,12)13/h1-3,7-10H,(H,11,12,13) |
| InChIKey | IKVJKXGKNZALCI-UHFFFAOYSA-N |
| XLogP | -0.02 |
| TPSA | 115.06 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.20 |
| LogP ≤ 5 | -0.02 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|