C7H6ClFO4S — CID 103574107
(4-chloro-3-fluorophenyl)-hydroxymethanesulfonic acid (PubChem CID 103574107) has the molecular formula C7H6ClFO4S and a molecular weight of 240.64 g/mol. Its IUPAC name is (4-chloro-3-fluorophenyl)-hydroxymethanesulfonic acid.
| Compound Name | (4-chloro-3-fluorophenyl)-hydroxymethanesulfonic acid |
|---|---|
| PubChem CID | 103574107 |
| Molecular Formula | C7H6ClFO4S |
| Molecular Weight | 240.64 g/mol |
| Exact Mass | 239.97 |
| IUPAC Name | (4-chloro-3-fluorophenyl)-hydroxymethanesulfonic acid |
| SMILES | O=S(=O)(O)C(O)c1ccc(Cl)c(F)c1 |
| InChI | InChI=1S/C7H6ClFO4S/c8-5-2-1-4(3-6(5)9)7(10)14(11,12)13/h1-3,7,10H,(H,11,12,13) |
| InChIKey | XUPACQVXOHUZBB-UHFFFAOYSA-N |
| XLogP | 1.36 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.64 |
| LogP ≤ 5 | 1.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|