C8H8O4 — CID 90657292
(2R)-2-(3,4-dihydroxyphenyl)-2-hydroxyacetaldehyde (PubChem CID 90657292) has the molecular formula C8H8O4 and a molecular weight of 168.15 g/mol. Its IUPAC name is (2R)-2-(3,4-dihydroxyphenyl)-2-hydroxyacetaldehyde.
| Compound Name | (2R)-2-(3,4-dihydroxyphenyl)-2-hydroxyacetaldehyde |
|---|---|
| PubChem CID | 90657292 |
| Molecular Formula | C8H8O4 |
| Molecular Weight | 168.15 g/mol |
| Exact Mass | 168.04 |
| IUPAC Name | (2R)-2-(3,4-dihydroxyphenyl)-2-hydroxyacetaldehyde |
| SMILES | O=C[C@H](O)c1ccc(O)c(O)c1 |
| InChI | InChI=1S/C8H8O4/c9-4-8(12)5-1-2-6(10)7(11)3-5/h1-4,8,10-12H/t8-/m0/s1 |
| InChIKey | YUGMCLJIWGEKCK-QMMMGPOBSA-N |
| XLogP | 0.33 |
| TPSA | 77.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 168.15 |
| LogP ≤ 5 | 0.33 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|