C9H9ClO3 — CID 88598261
3-chloro-3-(3,4-dihydroxyphenyl)propanal (PubChem CID 88598261) has the molecular formula C9H9ClO3 and a molecular weight of 200.62 g/mol. Its IUPAC name is 3-chloro-3-(3,4-dihydroxyphenyl)propanal.
| Compound Name | 3-chloro-3-(3,4-dihydroxyphenyl)propanal |
|---|---|
| PubChem CID | 88598261 |
| Molecular Formula | C9H9ClO3 |
| Molecular Weight | 200.62 g/mol |
| Exact Mass | 200.02 |
| IUPAC Name | 3-chloro-3-(3,4-dihydroxyphenyl)propanal |
| SMILES | O=CCC(Cl)c1ccc(O)c(O)c1 |
| InChI | InChI=1S/C9H9ClO3/c10-7(3-4-11)6-1-2-8(12)9(13)5-6/h1-2,4-5,7,12-13H,3H2 |
| InChIKey | HALOSIAWIIJMJB-UHFFFAOYSA-N |
| XLogP | 1.97 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 200.62 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|