C10H10O5 — CID 89390366
2-[(3,4-dihydroxyphenyl)-hydroxymethyl]prop-2-enoic acid (PubChem CID 89390366) has the molecular formula C10H10O5 and a molecular weight of 210.18 g/mol. Its IUPAC name is 2-[(3,4-dihydroxyphenyl)-hydroxymethyl]prop-2-enoic acid.
| Compound Name | 2-[(3,4-dihydroxyphenyl)-hydroxymethyl]prop-2-enoic acid |
|---|---|
| PubChem CID | 89390366 |
| Molecular Formula | C10H10O5 |
| Molecular Weight | 210.18 g/mol |
| Exact Mass | 210.05 |
| IUPAC Name | 2-[(3,4-dihydroxyphenyl)-hydroxymethyl]prop-2-enoic acid |
| SMILES | C=C(C(=O)O)C(O)c1ccc(O)c(O)c1 |
| InChI | InChI=1S/C10H10O5/c1-5(10(14)15)9(13)6-2-3-7(11)8(12)4-6/h2-4,9,11-13H,1H2,(H,14,15) |
| InChIKey | NDRPCRUJYPMCQJ-UHFFFAOYSA-N |
| XLogP | 0.77 |
| TPSA | 97.99 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.18 |
| LogP ≤ 5 | 0.77 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|