C12H16O5 — CID 66617202
butyl (2R)-2-(3,4-dihydroxyphenyl)-2-hydroxyacetate (PubChem CID 66617202) has the molecular formula C12H16O5 and a molecular weight of 240.25 g/mol. Its IUPAC name is butyl (2R)-2-(3,4-dihydroxyphenyl)-2-hydroxyacetate.
| Compound Name | butyl (2R)-2-(3,4-dihydroxyphenyl)-2-hydroxyacetate |
|---|---|
| PubChem CID | 66617202 |
| Molecular Formula | C12H16O5 |
| Molecular Weight | 240.25 g/mol |
| Exact Mass | 240.10 |
| IUPAC Name | butyl (2R)-2-(3,4-dihydroxyphenyl)-2-hydroxyacetate |
| SMILES | CCCCOC(=O)[C@H](O)c1ccc(O)c(O)c1 |
| InChI | InChI=1S/C12H16O5/c1-2-3-6-17-12(16)11(15)8-4-5-9(13)10(14)7-8/h4-5,7,11,13-15H,2-3,6H2,1H3/t11-/m1/s1 |
| InChIKey | JTLJURNKYZFRMM-LLVKDONJSA-N |
| XLogP | 1.47 |
| TPSA | 86.99 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.25 |
| LogP ≤ 5 | 1.47 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|