C19H22N2O9S — CID 59821494
2-[2-[[carboxy-(2-hydroxy-5-sulfophenyl)methyl]amino]ethylamino]-2-(2-hydroxy-5-methylphenyl)acetic acid (PubChem CID 59821494) has the molecular formula C19H22N2O9S and a molecular weight of 454.46 g/mol. Its IUPAC name is 2-[2-[[carboxy-(2-hydroxy-5-sulfophenyl)methyl]amino]ethylamino]-2-(2-hydroxy-5-methylphenyl)acetic acid.
| Compound Name | 2-[2-[[carboxy-(2-hydroxy-5-sulfophenyl)methyl]amino]ethylamino]-2-(2-hydroxy-5-methylphenyl)acetic acid |
|---|---|
| PubChem CID | 59821494 |
| Molecular Formula | C19H22N2O9S |
| Molecular Weight | 454.46 g/mol |
| Exact Mass | 454.10 |
| IUPAC Name | 2-[2-[[carboxy-(2-hydroxy-5-sulfophenyl)methyl]amino]ethylamino]-2-(2-hydroxy-5-methylphenyl)acetic acid |
| SMILES | Cc1ccc(O)c(C(NCCNC(C(=O)O)c2cc(S(=O)(=O)O)ccc2O)C(=O)O)c1 |
| InChI | InChI=1S/C19H22N2O9S/c1-10-2-4-14(22)12(8-10)16(18(24)25)20-6-7-21-17(19(26)27)13-9-11(31(28,29)30)3-5-15(13)23/h2-5,8-9,16-17,20-23H,6-7H2,1H3,(H,24,25)(H,26,27)(H,28,29,30) |
| InChIKey | XZTSJHQSVGNRBH-UHFFFAOYSA-N |
| XLogP | 0.78 |
| TPSA | 193.49 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.46 |
| LogP ≤ 5 | 0.78 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|