C18H21N3O5 — CID 71300819
2-[2-[[2-amino-1-(2-hydroxyphenyl)-2-oxoethyl]amino]ethylamino]-2-(2-hydroxyphenyl)acetic acid (PubChem CID 71300819) has the molecular formula C18H21N3O5 and a molecular weight of 359.38 g/mol. Its IUPAC name is 2-[2-[[2-amino-1-(2-hydroxyphenyl)-2-oxoethyl]amino]ethylamino]-2-(2-hydroxyphenyl)acetic acid.
| Compound Name | 2-[2-[[2-amino-1-(2-hydroxyphenyl)-2-oxoethyl]amino]ethylamino]-2-(2-hydroxyphenyl)acetic acid |
|---|---|
| PubChem CID | 71300819 |
| Molecular Formula | C18H21N3O5 |
| Molecular Weight | 359.38 g/mol |
| Exact Mass | 359.15 |
| IUPAC Name | 2-[2-[[2-amino-1-(2-hydroxyphenyl)-2-oxoethyl]amino]ethylamino]-2-(2-hydroxyphenyl)acetic acid |
| SMILES | NC(=O)C(NCCNC(C(=O)O)c1ccccc1O)c1ccccc1O |
| InChI | InChI=1S/C18H21N3O5/c19-17(24)15(11-5-1-3-7-13(11)22)20-9-10-21-16(18(25)26)12-6-2-4-8-14(12)23/h1-8,15-16,20-23H,9-10H2,(H2,19,24)(H,25,26) |
| InChIKey | SKRAIHIDRNGIAK-UHFFFAOYSA-N |
| XLogP | 0.63 |
| TPSA | 144.91 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.38 |
| LogP ≤ 5 | 0.63 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|