C10H13NO4 — CID 129275046
2-(2-hydroxyethylamino)-2-(2-hydroxyphenyl)acetic acid (PubChem CID 129275046) has the molecular formula C10H13NO4 and a molecular weight of 211.22 g/mol. Its IUPAC name is 2-(2-hydroxyethylamino)-2-(2-hydroxyphenyl)acetic acid.
| Compound Name | 2-(2-hydroxyethylamino)-2-(2-hydroxyphenyl)acetic acid |
|---|---|
| PubChem CID | 129275046 |
| Molecular Formula | C10H13NO4 |
| Molecular Weight | 211.22 g/mol |
| Exact Mass | 211.08 |
| IUPAC Name | 2-(2-hydroxyethylamino)-2-(2-hydroxyphenyl)acetic acid |
| SMILES | O=C(O)C(NCCO)c1ccccc1O |
| InChI | InChI=1S/C10H13NO4/c12-6-5-11-9(10(14)15)7-3-1-2-4-8(7)13/h1-4,9,11-13H,5-6H2,(H,14,15) |
| InChIKey | UIVXHZADVMDJBJ-UHFFFAOYSA-N |
| XLogP | 0.10 |
| TPSA | 89.79 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 211.22 |
| LogP ≤ 5 | 0.10 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|