C11H13NO5 — CID 12508749
2-(ethoxycarbonylamino)-2-(2-hydroxyphenyl)acetic acid (PubChem CID 12508749) has the molecular formula C11H13NO5 and a molecular weight of 239.23 g/mol. Its IUPAC name is 2-(ethoxycarbonylamino)-2-(2-hydroxyphenyl)acetic acid.
| Compound Name | 2-(ethoxycarbonylamino)-2-(2-hydroxyphenyl)acetic acid |
|---|---|
| PubChem CID | 12508749 |
| Molecular Formula | C11H13NO5 |
| Molecular Weight | 239.23 g/mol |
| Exact Mass | 239.08 |
| IUPAC Name | 2-(ethoxycarbonylamino)-2-(2-hydroxyphenyl)acetic acid |
| SMILES | CCOC(=O)NC(C(=O)O)c1ccccc1O |
| InChI | InChI=1S/C11H13NO5/c1-2-17-11(16)12-9(10(14)15)7-5-3-4-6-8(7)13/h3-6,9,13H,2H2,1H3,(H,12,16)(H,14,15) |
| InChIKey | WIZIJKJAZCKDAN-UHFFFAOYSA-N |
| XLogP | 1.26 |
| TPSA | 95.86 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.23 |
| LogP ≤ 5 | 1.26 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|