C18H20N2O6 — CID 141037281
2-[1-[[carboxy-(2-hydroxyphenyl)methyl]amino]ethylamino]-2-(2-hydroxyphenyl)acetic acid (PubChem CID 141037281) has the molecular formula C18H20N2O6 and a molecular weight of 360.37 g/mol. Its IUPAC name is 2-[1-[[carboxy-(2-hydroxyphenyl)methyl]amino]ethylamino]-2-(2-hydroxyphenyl)acetic acid.
| Compound Name | 2-[1-[[carboxy-(2-hydroxyphenyl)methyl]amino]ethylamino]-2-(2-hydroxyphenyl)acetic acid |
|---|---|
| PubChem CID | 141037281 |
| Molecular Formula | C18H20N2O6 |
| Molecular Weight | 360.37 g/mol |
| Exact Mass | 360.13 |
| IUPAC Name | 2-[1-[[carboxy-(2-hydroxyphenyl)methyl]amino]ethylamino]-2-(2-hydroxyphenyl)acetic acid |
| SMILES | CC(NC(C(=O)O)c1ccccc1O)NC(C(=O)O)c1ccccc1O |
| InChI | InChI=1S/C18H20N2O6/c1-10(19-15(17(23)24)11-6-2-4-8-13(11)21)20-16(18(25)26)12-7-3-5-9-14(12)22/h2-10,15-16,19-22H,1H3,(H,23,24)(H,25,26) |
| InChIKey | SSUFWRUZIQPNEH-UHFFFAOYSA-N |
| XLogP | 1.57 |
| TPSA | 139.12 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.37 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|