About 2-(1-nitrosoethyl)phenol
2-(1-nitrosoethyl)phenol (PubChem CID 54318967) has the molecular formula C8H9NO2
and a molecular weight of 151.16 g/mol. Its IUPAC name is 2-(1-nitrosoethyl)phenol.
Molecular Properties
| Compound Name | 2-(1-nitrosoethyl)phenol |
| PubChem CID | 54318967 |
| Molecular Formula | C8H9NO2 |
| Molecular Weight | 151.16 g/mol |
| Exact Mass | 151.06 |
| IUPAC Name | 2-(1-nitrosoethyl)phenol |
| SMILES | CC(N=O)c1ccccc1O |
| InChI | InChI=1S/C8H9NO2/c1-6(9-11)7-4-2-3-5-8(7)10/h2-6,10H,1H3 |
| InChIKey | SQGBVUJTAHWRCR-UHFFFAOYSA-N |
| XLogP | 2.22 |
| TPSA | 49.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 151.16 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|
Analyze 2-(1-nitrosoethyl)phenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(1-nitrosoethyl)phenol?
The IUPAC name of 2-(1-nitrosoethyl)phenol (CID 54318967) is 2-(1-nitrosoethyl)phenol.
What is the SMILES notation for 2-(1-nitrosoethyl)phenol?
The canonical SMILES for 2-(1-nitrosoethyl)phenol is CC(N=O)c1ccccc1O.
What is the InChIKey of 2-(1-nitrosoethyl)phenol?
The InChIKey is SQGBVUJTAHWRCR-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H9NO2/c1-6(9-11)7-4-2-3-5-8(7)10/h2-6,10H,1H3.
What are the key properties of 2-(1-nitrosoethyl)phenol?
2-(1-nitrosoethyl)phenol has a molecular weight of 151.16 g/mol, XLogP of 2.22, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(1-nitrosoethyl)phenol is sourced from PubChem (CID 54318967), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).