C21H24N4O4 — CID 91043530
N,N-dimethyl-N',N'-bis[2-(1-nitrosoethyl)phenyl]propanediamide (PubChem CID 91043530) has the molecular formula C21H24N4O4 and a molecular weight of 396.45 g/mol. Its IUPAC name is N,N-dimethyl-N',N'-bis[2-(1-nitrosoethyl)phenyl]propanediamide.
| Compound Name | N,N-dimethyl-N',N'-bis[2-(1-nitrosoethyl)phenyl]propanediamide |
|---|---|
| PubChem CID | 91043530 |
| Molecular Formula | C21H24N4O4 |
| Molecular Weight | 396.45 g/mol |
| Exact Mass | 396.18 |
| IUPAC Name | N,N-dimethyl-N',N'-bis[2-(1-nitrosoethyl)phenyl]propanediamide |
| SMILES | CC(N=O)c1ccccc1N(C(=O)CC(=O)N(C)C)c1ccccc1C(C)N=O |
| InChI | InChI=1S/C21H24N4O4/c1-14(22-28)16-9-5-7-11-18(16)25(21(27)13-20(26)24(3)4)19-12-8-6-10-17(19)15(2)23-29/h5-12,14-15H,13H2,1-4H3 |
| InChIKey | JSPWDARTGYRNLY-UHFFFAOYSA-N |
| XLogP | 4.48 |
| TPSA | 99.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.45 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|