C14H18N4O3 — CID 67157077
2-(2-hydroxyphenyl)-2-[2-[1H-imidazol-2-yl(methyl)amino]ethylamino]acetic acid (PubChem CID 67157077) has the molecular formula C14H18N4O3 and a molecular weight of 290.32 g/mol. Its IUPAC name is 2-(2-hydroxyphenyl)-2-[2-[1H-imidazol-2-yl(methyl)amino]ethylamino]acetic acid.
| Compound Name | 2-(2-hydroxyphenyl)-2-[2-[1H-imidazol-2-yl(methyl)amino]ethylamino]acetic acid |
|---|---|
| PubChem CID | 67157077 |
| Molecular Formula | C14H18N4O3 |
| Molecular Weight | 290.32 g/mol |
| Exact Mass | 290.14 |
| IUPAC Name | 2-(2-hydroxyphenyl)-2-[2-[1H-imidazol-2-yl(methyl)amino]ethylamino]acetic acid |
| SMILES | CN(CCNC(C(=O)O)c1ccccc1O)c1ncc[nH]1 |
| InChI | InChI=1S/C14H18N4O3/c1-18(14-16-6-7-17-14)9-8-15-12(13(20)21)10-4-2-3-5-11(10)19/h2-7,12,15,19H,8-9H2,1H3,(H,16,17)(H,20,21) |
| InChIKey | KPPPRFMLAALHJO-UHFFFAOYSA-N |
| XLogP | 0.97 |
| TPSA | 101.48 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.32 |
| LogP ≤ 5 | 0.97 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|