C7H9NO4S — CID 119081791
hydroxy-(5-methyl-3-pyridinyl)methanesulfonic acid (PubChem CID 119081791) has the molecular formula C7H9NO4S and a molecular weight of 203.22 g/mol. Its IUPAC name is hydroxy-(5-methyl-3-pyridinyl)methanesulfonic acid.
| Compound Name | hydroxy-(5-methyl-3-pyridinyl)methanesulfonic acid |
|---|---|
| PubChem CID | 119081791 |
| Molecular Formula | C7H9NO4S |
| Molecular Weight | 203.22 g/mol |
| Exact Mass | 203.03 |
| IUPAC Name | hydroxy-(5-methyl-3-pyridinyl)methanesulfonic acid |
| SMILES | Cc1cncc(C(O)S(=O)(=O)O)c1 |
| InChI | InChI=1S/C7H9NO4S/c1-5-2-6(4-8-3-5)7(9)13(10,11)12/h2-4,7,9H,1H3,(H,10,11,12) |
| InChIKey | NYLUAVLGNDZOBG-UHFFFAOYSA-N |
| XLogP | 0.27 |
| TPSA | 87.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 203.22 |
| LogP ≤ 5 | 0.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|