C10H15NO2 — CID 106677884
1-(5-methyl-3-pyridinyl)butane-1,4-diol (PubChem CID 106677884) has the molecular formula C10H15NO2 and a molecular weight of 181.23 g/mol. Its IUPAC name is 1-(5-methyl-3-pyridinyl)butane-1,4-diol.
| Compound Name | 1-(5-methyl-3-pyridinyl)butane-1,4-diol |
|---|---|
| PubChem CID | 106677884 |
| Molecular Formula | C10H15NO2 |
| Molecular Weight | 181.23 g/mol |
| Exact Mass | 181.11 |
| IUPAC Name | 1-(5-methyl-3-pyridinyl)butane-1,4-diol |
| SMILES | Cc1cncc(C(O)CCCO)c1 |
| InChI | InChI=1S/C10H15NO2/c1-8-5-9(7-11-6-8)10(13)3-2-4-12/h5-7,10,12-13H,2-4H2,1H3 |
| InChIKey | XBVPEZVKIWBYJJ-UHFFFAOYSA-N |
| XLogP | 1.20 |
| TPSA | 53.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 181.23 |
| LogP ≤ 5 | 1.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |