About 1-[2,2-bis(trifluoromethylsulfonyl)ethyl]-3,5-dimethylbenzene
1-[2,2-bis(trifluoromethylsulfonyl)ethyl]-3,5-dimethylbenzene (PubChem CID 139244912) has the molecular formula C12H12F6O4S2
and a molecular weight of 398.35 g/mol. Its IUPAC name is 1-[2,2-bis(trifluoromethylsulfonyl)ethyl]-3,5-dimethylbenzene.
Molecular Properties
| Compound Name | 1-[2,2-bis(trifluoromethylsulfonyl)ethyl]-3,5-dimethylbenzene |
| PubChem CID | 139244912 |
| Molecular Formula | C12H12F6O4S2 |
| Molecular Weight | 398.35 g/mol |
| Exact Mass | 398.01 |
| IUPAC Name | 1-[2,2-bis(trifluoromethylsulfonyl)ethyl]-3,5-dimethylbenzene |
| SMILES | Cc1cc(C)cc(CC(S(=O)(=O)C(F)(F)F)S(=O)(=O)C(F)(F)F)c1 |
| InChI | InChI=1S/C12H12F6O4S2/c1-7-3-8(2)5-9(4-7)6-10(23(19,20)11(13,14)15)24(21,22)12(16,17)18/h3-5,10H,6H2,1-2H3 |
| InChIKey | OADNNBLQUBQSCP-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 68.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 398.35 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 1-[2,2-bis(trifluoromethylsulfonyl)ethyl]-3,5-dimethylbenzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[2,2-bis(trifluoromethylsulfonyl)ethyl]-3,5-dimethylbenzene?
The IUPAC name of 1-[2,2-bis(trifluoromethylsulfonyl)ethyl]-3,5-dimethylbenzene (CID 139244912) is 1-[2,2-bis(trifluoromethylsulfonyl)ethyl]-3,5-dimethylbenzene.
What is the SMILES notation for 1-[2,2-bis(trifluoromethylsulfonyl)ethyl]-3,5-dimethylbenzene?
The canonical SMILES for 1-[2,2-bis(trifluoromethylsulfonyl)ethyl]-3,5-dimethylbenzene is Cc1cc(C)cc(CC(S(=O)(=O)C(F)(F)F)S(=O)(=O)C(F)(F)F)c1.
What is the InChIKey of 1-[2,2-bis(trifluoromethylsulfonyl)ethyl]-3,5-dimethylbenzene?
The InChIKey is OADNNBLQUBQSCP-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H12F6O4S2/c1-7-3-8(2)5-9(4-7)6-10(23(19,20)11(13,14)15)24(21,22)12(16,17)18/h3-5,10H,6H2,1-2H3.
What are the key properties of 1-[2,2-bis(trifluoromethylsulfonyl)ethyl]-3,5-dimethylbenzene?
1-[2,2-bis(trifluoromethylsulfonyl)ethyl]-3,5-dimethylbenzene has a molecular weight of 398.35 g/mol, XLogP of 3.04, 4 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[2,2-bis(trifluoromethylsulfonyl)ethyl]-3,5-dimethylbenzene is sourced from PubChem (CID 139244912), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).