C12H16F3NO2 — CID 69335044
azane;1-(2,4-dimethylphenyl)ethyl 2,2,2-trifluoroacetate (PubChem CID 69335044) has the molecular formula C12H16F3NO2 and a molecular weight of 263.26 g/mol. Its IUPAC name is azane;1-(2,4-dimethylphenyl)ethyl 2,2,2-trifluoroacetate.
| Compound Name | azane;1-(2,4-dimethylphenyl)ethyl 2,2,2-trifluoroacetate |
|---|---|
| PubChem CID | 69335044 |
| Molecular Formula | C12H16F3NO2 |
| Molecular Weight | 263.26 g/mol |
| Exact Mass | 263.11 |
| IUPAC Name | azane;1-(2,4-dimethylphenyl)ethyl 2,2,2-trifluoroacetate |
| SMILES | Cc1ccc(C(C)OC(=O)C(F)(F)F)c(C)c1.N |
| InChI | InChI=1S/C12H13F3O2.H3N/c1-7-4-5-10(8(2)6-7)9(3)17-11(16)12(13,14)15;/h4-6,9H,1-3H3;1H3 |
| InChIKey | AFCJTCPRBOZSQA-UHFFFAOYSA-N |
| XLogP | 3.63 |
| TPSA | 61.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.26 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |