C11H16N2O — CID 116843832
2-(2,4-dimethylphenyl)propanehydrazide (PubChem CID 116843832) has the molecular formula C11H16N2O and a molecular weight of 192.26 g/mol. Its IUPAC name is 2-(2,4-dimethylphenyl)propanehydrazide.
| Compound Name | 2-(2,4-dimethylphenyl)propanehydrazide |
|---|---|
| PubChem CID | 116843832 |
| Molecular Formula | C11H16N2O |
| Molecular Weight | 192.26 g/mol |
| Exact Mass | 192.13 |
| IUPAC Name | 2-(2,4-dimethylphenyl)propanehydrazide |
| SMILES | Cc1ccc(C(C)C(=O)NN)c(C)c1 |
| InChI | InChI=1S/C11H16N2O/c1-7-4-5-10(8(2)6-7)9(3)11(14)13-12/h4-6,9H,12H2,1-3H3,(H,13,14) |
| InChIKey | DHKSLCQJRWWTON-UHFFFAOYSA-N |
| XLogP | 1.40 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 192.26 |
| LogP ≤ 5 | 1.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|