C10H8F8N2O3S — CID 101042278
1,1,2,2-tetrafluoro-2-[1,1,2,2-tetrafluoro-2-(4-methyl-3-pyridinyl)ethoxy]ethanesulfonamide (PubChem CID 101042278) has the molecular formula C10H8F8N2O3S and a molecular weight of 388.24 g/mol. Its IUPAC name is 1,1,2,2-tetrafluoro-2-[1,1,2,2-tetrafluoro-2-(4-methyl-3-pyridinyl)ethoxy]ethanesulfonamide.
| Compound Name | 1,1,2,2-tetrafluoro-2-[1,1,2,2-tetrafluoro-2-(4-methyl-3-pyridinyl)ethoxy]ethanesulfonamide |
|---|---|
| PubChem CID | 101042278 |
| Molecular Formula | C10H8F8N2O3S |
| Molecular Weight | 388.24 g/mol |
| Exact Mass | 388.01 |
| IUPAC Name | 1,1,2,2-tetrafluoro-2-[1,1,2,2-tetrafluoro-2-(4-methyl-3-pyridinyl)ethoxy]ethanesulfonamide |
| SMILES | Cc1ccncc1C(F)(F)C(F)(F)OC(F)(F)C(F)(F)S(N)(=O)=O |
| InChI | InChI=1S/C10H8F8N2O3S/c1-5-2-3-20-4-6(5)7(11,12)8(13,14)23-9(15,16)10(17,18)24(19,21)22/h2-4H,1H3,(H2,19,21,22) |
| InChIKey | YMJQWBMPXDMGJC-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 82.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.24 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|