C9H11F3N2 — CID 130765840
(1S)-1-(4-ethyl-3-pyridinyl)-2,2,2-trifluoroethanamine (PubChem CID 130765840) has the molecular formula C9H11F3N2 and a molecular weight of 204.19 g/mol. Its IUPAC name is (1S)-1-(4-ethyl-3-pyridinyl)-2,2,2-trifluoroethanamine.
| Compound Name | (1S)-1-(4-ethyl-3-pyridinyl)-2,2,2-trifluoroethanamine |
|---|---|
| PubChem CID | 130765840 |
| Molecular Formula | C9H11F3N2 |
| Molecular Weight | 204.19 g/mol |
| Exact Mass | 204.09 |
| IUPAC Name | (1S)-1-(4-ethyl-3-pyridinyl)-2,2,2-trifluoroethanamine |
| SMILES | CCc1ccncc1[C@H](N)C(F)(F)F |
| InChI | InChI=1S/C9H11F3N2/c1-2-6-3-4-14-5-7(6)8(13)9(10,11)12/h3-5,8H,2,13H2,1H3/t8-/m0/s1 |
| InChIKey | QNAPLUXPGCWXJE-QMMMGPOBSA-N |
| XLogP | 2.21 |
| TPSA | 38.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 204.19 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |