C11H19N — CID 90914060
3,4-diethylpyridine;ethane (PubChem CID 90914060) has the molecular formula C11H19N and a molecular weight of 165.28 g/mol. Its IUPAC name is 3,4-diethylpyridine;ethane.
| Compound Name | 3,4-diethylpyridine;ethane |
|---|---|
| PubChem CID | 90914060 |
| Molecular Formula | C11H19N |
| Molecular Weight | 165.28 g/mol |
| Exact Mass | 165.15 |
| IUPAC Name | 3,4-diethylpyridine;ethane |
| SMILES | CC.CCc1ccncc1CC |
| InChI | InChI=1S/C9H13N.C2H6/c1-3-8-5-6-10-7-9(8)4-2;1-2/h5-7H,3-4H2,1-2H3;1-2H3 |
| InChIKey | WWYMKVVDJCENRG-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 165.28 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |