C17H12F5N3O2S — CID 22998040
4-[2-[4-(difluoromethyl)phenyl]-4-(trifluoromethyl)imidazol-1-yl]benzenesulfonamide (PubChem CID 22998040) has the molecular formula C17H12F5N3O2S and a molecular weight of 417.36 g/mol. Its IUPAC name is 4-[2-[4-(difluoromethyl)phenyl]-4-(trifluoromethyl)imidazol-1-yl]benzenesulfonamide.
| Compound Name | 4-[2-[4-(difluoromethyl)phenyl]-4-(trifluoromethyl)imidazol-1-yl]benzenesulfonamide |
|---|---|
| PubChem CID | 22998040 |
| Molecular Formula | C17H12F5N3O2S |
| Molecular Weight | 417.36 g/mol |
| Exact Mass | 417.06 |
| IUPAC Name | 4-[2-[4-(difluoromethyl)phenyl]-4-(trifluoromethyl)imidazol-1-yl]benzenesulfonamide |
| SMILES | NS(=O)(=O)c1ccc(-n2cc(C(F)(F)F)nc2-c2ccc(C(F)F)cc2)cc1 |
| InChI | InChI=1S/C17H12F5N3O2S/c18-15(19)10-1-3-11(4-2-10)16-24-14(17(20,21)22)9-25(16)12-5-7-13(8-6-12)28(23,26)27/h1-9,15H,(H2,23,26,27) |
| InChIKey | UYCOFPXXZBELQY-UHFFFAOYSA-N |
| XLogP | 4.14 |
| TPSA | 77.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.36 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |