C21H25F3N2O2S — CID 143007243
ethane;1-(4-methylsulfonylphenyl)-2-phenyl-4-(trifluoromethyl)imidazole (PubChem CID 143007243) has the molecular formula C21H25F3N2O2S and a molecular weight of 426.50 g/mol. Its IUPAC name is ethane;1-(4-methylsulfonylphenyl)-2-phenyl-4-(trifluoromethyl)imidazole.
| Compound Name | ethane;1-(4-methylsulfonylphenyl)-2-phenyl-4-(trifluoromethyl)imidazole |
|---|---|
| PubChem CID | 143007243 |
| Molecular Formula | C21H25F3N2O2S |
| Molecular Weight | 426.50 g/mol |
| Exact Mass | 426.16 |
| IUPAC Name | ethane;1-(4-methylsulfonylphenyl)-2-phenyl-4-(trifluoromethyl)imidazole |
| SMILES | CC.CC.CS(=O)(=O)c1ccc(-n2cc(C(F)(F)F)nc2-c2ccccc2)cc1 |
| InChI | InChI=1S/C17H13F3N2O2S.2C2H6/c1-25(23,24)14-9-7-13(8-10-14)22-11-15(17(18,19)20)21-16(22)12-5-3-2-4-6-12;2*1-2/h2-11H,1H3;2*1-2H3 |
| InChIKey | AOXTWALCODGXLJ-UHFFFAOYSA-N |
| XLogP | 6.01 |
| TPSA | 51.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.50 |
| LogP ≤ 5 | 6.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |