C18H15F3N2O2S2 — CID 10764155
2-(3-methylsulfanylphenyl)-1-(4-methylsulfonylphenyl)-4-(trifluoromethyl)imidazole (PubChem CID 10764155) has the molecular formula C18H15F3N2O2S2 and a molecular weight of 412.46 g/mol. Its IUPAC name is 2-(3-methylsulfanylphenyl)-1-(4-methylsulfonylphenyl)-4-(trifluoromethyl)imidazole.
| Compound Name | 2-(3-methylsulfanylphenyl)-1-(4-methylsulfonylphenyl)-4-(trifluoromethyl)imidazole |
|---|---|
| PubChem CID | 10764155 |
| Molecular Formula | C18H15F3N2O2S2 |
| Molecular Weight | 412.46 g/mol |
| Exact Mass | 412.05 |
| IUPAC Name | 2-(3-methylsulfanylphenyl)-1-(4-methylsulfonylphenyl)-4-(trifluoromethyl)imidazole |
| SMILES | CSc1cccc(-c2nc(C(F)(F)F)cn2-c2ccc(S(C)(=O)=O)cc2)c1 |
| InChI | InChI=1S/C18H15F3N2O2S2/c1-26-14-5-3-4-12(10-14)17-22-16(18(19,20)21)11-23(17)13-6-8-15(9-7-13)27(2,24)25/h3-11H,1-2H3 |
| InChIKey | RXTKEXGDJYGJHQ-UHFFFAOYSA-N |
| XLogP | 4.68 |
| TPSA | 51.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.46 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |