C15H12ClF3N4O2S — CID 139827326
1-chloro-5-[1-(4-methylsulfonylphenyl)-4-(trifluoromethyl)imidazol-2-yl]-2H-pyrimidine (PubChem CID 139827326) has the molecular formula C15H12ClF3N4O2S and a molecular weight of 404.80 g/mol. Its IUPAC name is 1-chloro-5-[1-(4-methylsulfonylphenyl)-4-(trifluoromethyl)imidazol-2-yl]-2H-pyrimidine.
| Compound Name | 1-chloro-5-[1-(4-methylsulfonylphenyl)-4-(trifluoromethyl)imidazol-2-yl]-2H-pyrimidine |
|---|---|
| PubChem CID | 139827326 |
| Molecular Formula | C15H12ClF3N4O2S |
| Molecular Weight | 404.80 g/mol |
| Exact Mass | 404.03 |
| IUPAC Name | 1-chloro-5-[1-(4-methylsulfonylphenyl)-4-(trifluoromethyl)imidazol-2-yl]-2H-pyrimidine |
| SMILES | CS(=O)(=O)c1ccc(-n2cc(C(F)(F)F)nc2C2=CN(Cl)CN=C2)cc1 |
| InChI | InChI=1S/C15H12ClF3N4O2S/c1-26(24,25)12-4-2-11(3-5-12)23-8-13(15(17,18)19)21-14(23)10-6-20-9-22(16)7-10/h2-8H,9H2,1H3 |
| InChIKey | ALJQLYDVBNKONS-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 67.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.80 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'N-halo', 'substructure': 'N/A'} |
|---|