C11H16O5S — CID 102620734
1-(2,5-dimethoxyphenyl)ethyl methanesulfonate (PubChem CID 102620734) has the molecular formula C11H16O5S and a molecular weight of 260.31 g/mol. Its IUPAC name is 1-(2,5-dimethoxyphenyl)ethyl methanesulfonate.
| Compound Name | 1-(2,5-dimethoxyphenyl)ethyl methanesulfonate |
|---|---|
| PubChem CID | 102620734 |
| Molecular Formula | C11H16O5S |
| Molecular Weight | 260.31 g/mol |
| Exact Mass | 260.07 |
| IUPAC Name | 1-(2,5-dimethoxyphenyl)ethyl methanesulfonate |
| SMILES | COc1ccc(OC)c(C(C)OS(C)(=O)=O)c1 |
| InChI | InChI=1S/C11H16O5S/c1-8(16-17(4,12)13)10-7-9(14-2)5-6-11(10)15-3/h5-8H,1-4H3 |
| InChIKey | XWRLSHWAGWKYIO-UHFFFAOYSA-N |
| XLogP | 1.74 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.31 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|