C11H16BrNO4S — CID 99616093
1-bromo-N-[(1S)-1-(2,5-dimethoxyphenyl)ethyl]methanesulfonamide (PubChem CID 99616093) has the molecular formula C11H16BrNO4S and a molecular weight of 338.22 g/mol. Its IUPAC name is 1-bromo-N-[(1S)-1-(2,5-dimethoxyphenyl)ethyl]methanesulfonamide.
| Compound Name | 1-bromo-N-[(1S)-1-(2,5-dimethoxyphenyl)ethyl]methanesulfonamide |
|---|---|
| PubChem CID | 99616093 |
| Molecular Formula | C11H16BrNO4S |
| Molecular Weight | 338.22 g/mol |
| Exact Mass | 337.00 |
| IUPAC Name | 1-bromo-N-[(1S)-1-(2,5-dimethoxyphenyl)ethyl]methanesulfonamide |
| SMILES | COc1ccc(OC)c([C@H](C)NS(=O)(=O)CBr)c1 |
| InChI | InChI=1S/C11H16BrNO4S/c1-8(13-18(14,15)7-12)10-6-9(16-2)4-5-11(10)17-3/h4-6,8,13H,7H2,1-3H3/t8-/m0/s1 |
| InChIKey | HLXHQEUOPRZRNQ-QMMMGPOBSA-N |
| XLogP | 2.04 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.22 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|