C22H24N2O6 — CID 110596942
3-(2,5-dimethoxyanilino)-4-(3,4-dimethoxyphenyl)-1-ethylpyrrole-2,5-dione (PubChem CID 110596942) has the molecular formula C22H24N2O6 and a molecular weight of 412.44 g/mol. Its IUPAC name is 3-(2,5-dimethoxyanilino)-4-(3,4-dimethoxyphenyl)-1-ethylpyrrole-2,5-dione.
| Compound Name | 3-(2,5-dimethoxyanilino)-4-(3,4-dimethoxyphenyl)-1-ethylpyrrole-2,5-dione |
|---|---|
| PubChem CID | 110596942 |
| Molecular Formula | C22H24N2O6 |
| Molecular Weight | 412.44 g/mol |
| Exact Mass | 412.16 |
| IUPAC Name | 3-(2,5-dimethoxyanilino)-4-(3,4-dimethoxyphenyl)-1-ethylpyrrole-2,5-dione |
| SMILES | CCN1C(=O)C(Nc2cc(OC)ccc2OC)=C(c2ccc(OC)c(OC)c2)C1=O |
| InChI | InChI=1S/C22H24N2O6/c1-6-24-21(25)19(13-7-9-17(29-4)18(11-13)30-5)20(22(24)26)23-15-12-14(27-2)8-10-16(15)28-3/h7-12,23H,6H2,1-5H3 |
| InChIKey | QWEJGVKKEQZKPA-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 86.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.44 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|