C24H28N2O5 — CID 110587983
3-(2,5-dimethoxyanilino)-4-(4-ethoxyphenyl)-1-(2-methylpropyl)pyrrole-2,5-dione (PubChem CID 110587983) has the molecular formula C24H28N2O5 and a molecular weight of 424.50 g/mol. Its IUPAC name is 3-(2,5-dimethoxyanilino)-4-(4-ethoxyphenyl)-1-(2-methylpropyl)pyrrole-2,5-dione.
| Compound Name | 3-(2,5-dimethoxyanilino)-4-(4-ethoxyphenyl)-1-(2-methylpropyl)pyrrole-2,5-dione |
|---|---|
| PubChem CID | 110587983 |
| Molecular Formula | C24H28N2O5 |
| Molecular Weight | 424.50 g/mol |
| Exact Mass | 424.20 |
| IUPAC Name | 3-(2,5-dimethoxyanilino)-4-(4-ethoxyphenyl)-1-(2-methylpropyl)pyrrole-2,5-dione |
| SMILES | CCOc1ccc(C2=C(Nc3cc(OC)ccc3OC)C(=O)N(CC(C)C)C2=O)cc1 |
| InChI | InChI=1S/C24H28N2O5/c1-6-31-17-9-7-16(8-10-17)21-22(24(28)26(23(21)27)14-15(2)3)25-19-13-18(29-4)11-12-20(19)30-5/h7-13,15,25H,6,14H2,1-5H3 |
| InChIKey | PZUIYQUXJLTEMF-UHFFFAOYSA-N |
| XLogP | 3.95 |
| TPSA | 77.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.50 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|