C23H26N2O4 — CID 110588848
3-(2,5-dimethoxyanilino)-4-(3,4-dimethylphenyl)-1-propylpyrrole-2,5-dione (PubChem CID 110588848) has the molecular formula C23H26N2O4 and a molecular weight of 394.47 g/mol. Its IUPAC name is 3-(2,5-dimethoxyanilino)-4-(3,4-dimethylphenyl)-1-propylpyrrole-2,5-dione.
| Compound Name | 3-(2,5-dimethoxyanilino)-4-(3,4-dimethylphenyl)-1-propylpyrrole-2,5-dione |
|---|---|
| PubChem CID | 110588848 |
| Molecular Formula | C23H26N2O4 |
| Molecular Weight | 394.47 g/mol |
| Exact Mass | 394.19 |
| IUPAC Name | 3-(2,5-dimethoxyanilino)-4-(3,4-dimethylphenyl)-1-propylpyrrole-2,5-dione |
| SMILES | CCCN1C(=O)C(Nc2cc(OC)ccc2OC)=C(c2ccc(C)c(C)c2)C1=O |
| InChI | InChI=1S/C23H26N2O4/c1-6-11-25-22(26)20(16-8-7-14(2)15(3)12-16)21(23(25)27)24-18-13-17(28-4)9-10-19(18)29-5/h7-10,12-13,24H,6,11H2,1-5H3 |
| InChIKey | VSAUBSNMLDRILO-UHFFFAOYSA-N |
| XLogP | 3.92 |
| TPSA | 67.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.47 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|