C27H22N2O4 — CID 30225315
2-[(3S,4R)-3-(3,4-dimethoxyphenyl)-4-phenyl-3,4-dihydropyridazin-6-yl]-3-hydroxyinden-1-one (PubChem CID 30225315) has the molecular formula C27H22N2O4 and a molecular weight of 438.48 g/mol. Its IUPAC name is 2-[(3S,4R)-3-(3,4-dimethoxyphenyl)-4-phenyl-3,4-dihydropyridazin-6-yl]-3-hydroxyinden-1-one.
| Compound Name | 2-[(3S,4R)-3-(3,4-dimethoxyphenyl)-4-phenyl-3,4-dihydropyridazin-6-yl]-3-hydroxyinden-1-one |
|---|---|
| PubChem CID | 30225315 |
| Molecular Formula | C27H22N2O4 |
| Molecular Weight | 438.48 g/mol |
| Exact Mass | 438.16 |
| IUPAC Name | 2-[(3S,4R)-3-(3,4-dimethoxyphenyl)-4-phenyl-3,4-dihydropyridazin-6-yl]-3-hydroxyinden-1-one |
| SMILES | COc1ccc([C@H]2N=NC(C3=C(O)c4ccccc4C3=O)=C[C@@H]2c2ccccc2)cc1OC |
| InChI | InChI=1S/C27H22N2O4/c1-32-22-13-12-17(14-23(22)33-2)25-20(16-8-4-3-5-9-16)15-21(28-29-25)24-26(30)18-10-6-7-11-19(18)27(24)31/h3-15,20,25,30H,1-2H3/t20-,25-/m1/s1 |
| InChIKey | CWCJJWBHQFIGHA-CJFMBICVSA-N |
| XLogP | 6.04 |
| TPSA | 80.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.48 |
| LogP ≤ 5 | 6.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'keto_keto_beta_C(7)', 'substructure': 'N/A'} |
|---|