C23H23N5O4 — CID 91503513
3-[1-[[2-[[3-(diaminomethylideneamino)benzoyl]amino]acetyl]amino]naphthalen-2-yl]propanoic acid (PubChem CID 91503513) has the molecular formula C23H23N5O4 and a molecular weight of 433.47 g/mol. Its IUPAC name is 3-[1-[[2-[[3-(diaminomethylideneamino)benzoyl]amino]acetyl]amino]naphthalen-2-yl]propanoic acid.
| Compound Name | 3-[1-[[2-[[3-(diaminomethylideneamino)benzoyl]amino]acetyl]amino]naphthalen-2-yl]propanoic acid |
|---|---|
| PubChem CID | 91503513 |
| Molecular Formula | C23H23N5O4 |
| Molecular Weight | 433.47 g/mol |
| Exact Mass | 433.18 |
| IUPAC Name | 3-[1-[[2-[[3-(diaminomethylideneamino)benzoyl]amino]acetyl]amino]naphthalen-2-yl]propanoic acid |
| SMILES | NC(N)=Nc1cccc(C(=O)NCC(=O)Nc2c(CCC(=O)O)ccc3ccccc23)c1 |
| InChI | InChI=1S/C23H23N5O4/c24-23(25)27-17-6-3-5-16(12-17)22(32)26-13-19(29)28-21-15(10-11-20(30)31)9-8-14-4-1-2-7-18(14)21/h1-9,12H,10-11,13H2,(H,26,32)(H,28,29)(H,30,31)(H4,24,25,27) |
| InChIKey | RCYJEFWQKIOLLS-UHFFFAOYSA-N |
| XLogP | 2.13 |
| TPSA | 159.90 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.47 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|