C25H27Cl2N5O8 — CID 136601206
3-[2-[[2-[[3-[bis(ethoxycarbonylamino)methylideneamino]benzoyl]amino]acetyl]amino]-3,5-dichlorophenyl]propanoic acid (PubChem CID 136601206) has the molecular formula C25H27Cl2N5O8 and a molecular weight of 596.42 g/mol. Its IUPAC name is 3-[2-[[2-[[3-[bis(ethoxycarbonylamino)methylideneamino]benzoyl]amino]acetyl]amino]-3,5-dichlorophenyl]propanoic acid.
| Compound Name | 3-[2-[[2-[[3-[bis(ethoxycarbonylamino)methylideneamino]benzoyl]amino]acetyl]amino]-3,5-dichlorophenyl]propanoic acid |
|---|---|
| PubChem CID | 136601206 |
| Molecular Formula | C25H27Cl2N5O8 |
| Molecular Weight | 596.42 g/mol |
| Exact Mass | 595.12 |
| IUPAC Name | 3-[2-[[2-[[3-[bis(ethoxycarbonylamino)methylideneamino]benzoyl]amino]acetyl]amino]-3,5-dichlorophenyl]propanoic acid |
| SMILES | CCOC(=O)NC(=Nc1cccc(C(=O)NCC(=O)Nc2c(Cl)cc(Cl)cc2CCC(=O)O)c1)NC(=O)OCC |
| InChI | InChI=1S/C25H27Cl2N5O8/c1-3-39-24(37)31-23(32-25(38)40-4-2)29-17-7-5-6-15(11-17)22(36)28-13-19(33)30-21-14(8-9-20(34)35)10-16(26)12-18(21)27/h5-7,10-12H,3-4,8-9,13H2,1-2H3,(H,28,36)(H,30,33)(H,34,35)(H2,29,31,32,37,38) |
| InChIKey | WRSOKQANINWHRE-UHFFFAOYSA-N |
| XLogP | 3.86 |
| TPSA | 184.52 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 596.42 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|