C19H18Cl3N5O4 — CID 139810284
3-[3,5-dichloro-2-[[2-[[4-chloro-3-(hydrazinylmethylideneamino)benzoyl]amino]acetyl]amino]phenyl]propanoic acid (PubChem CID 139810284) has the molecular formula C19H18Cl3N5O4 and a molecular weight of 486.74 g/mol. Its IUPAC name is 3-[3,5-dichloro-2-[[2-[[4-chloro-3-(hydrazinylmethylideneamino)benzoyl]amino]acetyl]amino]phenyl]propanoic acid.
| Compound Name | 3-[3,5-dichloro-2-[[2-[[4-chloro-3-(hydrazinylmethylideneamino)benzoyl]amino]acetyl]amino]phenyl]propanoic acid |
|---|---|
| PubChem CID | 139810284 |
| Molecular Formula | C19H18Cl3N5O4 |
| Molecular Weight | 486.74 g/mol |
| Exact Mass | 485.04 |
| IUPAC Name | 3-[3,5-dichloro-2-[[2-[[4-chloro-3-(hydrazinylmethylideneamino)benzoyl]amino]acetyl]amino]phenyl]propanoic acid |
| SMILES | NN/C=N/c1cc(C(=O)NCC(=O)Nc2c(Cl)cc(Cl)cc2CCC(=O)O)ccc1Cl |
| InChI | InChI=1S/C19H18Cl3N5O4/c20-12-5-10(2-4-17(29)30)18(14(22)7-12)27-16(28)8-24-19(31)11-1-3-13(21)15(6-11)25-9-26-23/h1,3,5-7,9H,2,4,8,23H2,(H,24,31)(H,25,26)(H,27,28)(H,29,30) |
| InChIKey | DRGVRESJXOHISQ-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 145.91 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.74 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|