C19H20FN5O4 — CID 70059567
3-[4-fluoro-2-[[2-[[3-(hydrazinylmethylideneamino)benzoyl]amino]acetyl]amino]phenyl]propanoic acid (PubChem CID 70059567) has the molecular formula C19H20FN5O4 and a molecular weight of 401.40 g/mol. Its IUPAC name is 3-[4-fluoro-2-[[2-[[3-(hydrazinylmethylideneamino)benzoyl]amino]acetyl]amino]phenyl]propanoic acid.
| Compound Name | 3-[4-fluoro-2-[[2-[[3-(hydrazinylmethylideneamino)benzoyl]amino]acetyl]amino]phenyl]propanoic acid |
|---|---|
| PubChem CID | 70059567 |
| Molecular Formula | C19H20FN5O4 |
| Molecular Weight | 401.40 g/mol |
| Exact Mass | 401.15 |
| IUPAC Name | 3-[4-fluoro-2-[[2-[[3-(hydrazinylmethylideneamino)benzoyl]amino]acetyl]amino]phenyl]propanoic acid |
| SMILES | NN/C=N/c1cccc(C(=O)NCC(=O)Nc2cc(F)ccc2CCC(=O)O)c1 |
| InChI | InChI=1S/C19H20FN5O4/c20-14-6-4-12(5-7-18(27)28)16(9-14)25-17(26)10-22-19(29)13-2-1-3-15(8-13)23-11-24-21/h1-4,6,8-9,11H,5,7,10,21H2,(H,22,29)(H,23,24)(H,25,26)(H,27,28) |
| InChIKey | MIJLHWPOVOVEBF-UHFFFAOYSA-N |
| XLogP | 1.33 |
| TPSA | 145.91 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.40 |
| LogP ≤ 5 | 1.33 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|